For research use only. Not for therapeutic Use.
5-Aza-1H-indazole is a heterocyclic compound featuring an indazole ring structure with a nitrogen atom replacing a carbon at the 5th position. This modification enhances its chemical reactivity and biological properties, making it of interest in medicinal chemistry. Indazole derivatives are commonly studied for their potential as therapeutic agents, particularly for their anticancer, anti-inflammatory, and antimicrobial activities. Researchers explore 5-Aza-1H-indazole in drug discovery, aiming to develop novel bioactive compounds targeting various diseases by modifying its structure for improved efficacy.
CAS Number | 271-52-3 |
Synonyms | 1H-Pyrazolo[4,3-c]pyridine |
Molecular Formula | C6H5N3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1H-pyrazolo[4,3-c]pyridine |
InChI | InChI=1S/C6H5N3/c1-2-7-3-5-4-8-9-6(1)5/h1-4H,(H,8,9) |
InChIKey | WCXFPLXZZSWROM-UHFFFAOYSA-N |
SMILES | C1=CN=CC2=C1NN=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |