For research use only. Not for therapeutic Use.
5-Aza-7-deaza Guanosine is a synthetic nucleoside analog, commonly utilized in molecular biology and biochemical research. This compound plays a crucial role in the study of nucleic acid structure, function, and metabolism, particularly in the investigation of DNA and RNA interactions. Its modified structure allows for the exploration of alternative base pairing and the development of novel therapeutic agents. With high stability and specificity, 5-Aza-7-deaza Guanosine is indispensable for advanced genetic research, drug development, and epigenetic studies.
CAS Number | 67410-65-5 |
Synonyms | 2-Amino-8-β-D-ribofuranosylimidazo[1,2-a]-1,3,5-triazin-4(8H)-one; NSC 344511; ZX 2401; |
Molecular Formula | C₁₀H₁₃N₅O₅ |
Purity | ≥95% |
Storage | Store at -20°C |
InChI | 1S/C10H13N5O5/c11-8-12-9-14(1-2-15(9)10(19)13-8)7-6(18)5(17)4(3-16)20-7/h1-2,4-7,16-18H,3H2,(H2,11,13,19)/t4-,5-,6-,7-/m1/s1 |
InChIKey | ZQUTYCUKRGSIGL-DBRKOABJSA-N |
SMILES | C1=CN2C(=NC(=NC2=O)N)N1[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |