For research use only. Not for therapeutic Use.
5-Benzylidene-3-ethyl rhodanine(Cat No.: M086298) is an organic compound that belongs to the rhodanine family, which is known for its diverse pharmacological properties. It has shown potential as an inhibitor of various enzymes and receptors, particularly those involved in cancer cell proliferation and apoptosis. The compound exhibits antioxidant, anti-inflammatory, and antimicrobial activities. 5-Benzylidene-3-ethyl rhodanine is also being studied for its potential in treating metabolic disorders, neurodegenerative diseases, and as a lead molecule for developing new therapeutic agents in drug discovery.
CAS Number | 18331-34-5 |
Molecular Formula | C12H11NOS2 |
Purity | ≥95% |
Target | Apoptosis |
Storage | 2-8°C |
IUPAC Name | (1S,2R,9S,10R,12S)-4,9-dimethyl-13-methylidene-6-oxatetracyclo[7.4.0.03,7.010,12]trideca-3(7),4-dien-2-ol |
InChI | InChI=1S/C15H18O2/c1-7-6-17-11-5-15(3)10-4-9(10)8(2)13(15)14(16)12(7)11/h6,9-10,13-14,16H,2,4-5H2,1,3H3/t9-,10-,13-,14+,15+/m1/s1 |
InChIKey | XRDJYSVGPBJZSG-PSDLAXTLSA-N |
SMILES | CC1=COC2=C1C(C3C(=C)C4CC4C3(C2)C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |