For research use only. Not for therapeutic Use.
5-(Benzyloxy)-7-bromobenzo[d]thiazole is an aromatic compound characterized by a benzo[d]thiazole core, with a benzyloxy substituent at the fifth position and a bromine atom at the seventh position. This unique arrangement enhances its electronic properties, making it a valuable intermediate in organic synthesis. The compound’s reactivity can facilitate the development of pharmaceuticals and agrochemicals. Its structure may also offer potential applications in materials science, particularly in the creation of novel compounds with specific functionalities or biological activities.
CAS Number | 1650547-09-3 |
Molecular Formula | C14H10BrNOS |
Purity | ≥95% |
IUPAC Name | 7-bromo-5-phenylmethoxy-1,3-benzothiazole |
InChI | InChI=1S/C14H10BrNOS/c15-12-6-11(7-13-14(12)18-9-16-13)17-8-10-4-2-1-3-5-10/h1-7,9H,8H2 |
InChIKey | CKXCTNOCHCLYJH-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC2=CC3=C(C(=C2)Br)SC=N3 |