For research use only. Not for therapeutic Use.
5-Bromo-1-chloro-3-fluoro-2-iodobenzene(CAT: L038281) is a highly halogenated benzene derivative with bromine, chlorine, fluorine, and iodine atoms positioned around the aromatic ring. This unique structure, with multiple halogen substituents, makes it an excellent starting material for cross-coupling reactions, such as Suzuki, Sonogashira, and Buchwald-Hartwig couplings. Its diverse halogenation pattern offers various reactivity profiles for each halogen, allowing selective transformations based on reaction conditions. Due to its versatility, this compound is valuable in synthesizing complex organic molecules, particularly in pharmaceuticals and materials science. Its halogen substituents also contribute to studies on molecular interactions, where halogen bonding can play a role in designing advanced materials and biologically active compounds.
Catalog Number | L038281 |
CAS Number | 83027-73-0 |
Molecular Formula | C6H2BrClFI |
Purity | ≥95% |
IUPAC Name | 5-bromo-1-chloro-3-fluoro-2-iodobenzene |
InChI | InChI=1S/C6H2BrClFI/c7-3-1-4(8)6(10)5(9)2-3/h1-2H |
InChIKey | WQAABVMKMRFARY-UHFFFAOYSA-N |