For research use only. Not for therapeutic Use.
5-Bromo-1-ethyl-1H-pyrazole-4-carbonitrile(CAT: L016438) is a high-purity heterocyclic compound featuring a brominated pyrazole core with an ethyl substitution at the 1-position and a carbonitrile functional group at the 4-position. This versatile molecule is widely utilized in pharmaceutical and chemical research as a building block for synthesizing complex organic compounds and bioactive molecules. Its unique combination of functional groups makes it particularly valuable in medicinal chemistry for the development of novel therapeutic agents. With reliable quality and consistent performance, 5-Bromo-1-ethyl-1H-pyrazole-4-carbonitrile supports innovative research in drug discovery and organic synthesis.
CAS Number | 1823838-43-2 |
Molecular Formula | C6H6BrN3 |
Purity | ≥95% |
IUPAC Name | 5-bromo-1-ethylpyrazole-4-carbonitrile |
InChI | InChI=1S/C6H6BrN3/c1-2-10-6(7)5(3-8)4-9-10/h4H,2H2,1H3 |
InChIKey | KGXFZJPHLWMXFT-UHFFFAOYSA-N |
SMILES | CCN1C(=C(C=N1)C#N)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |