For research use only. Not for therapeutic Use.
5-Bromo-1-ethylpyridin-2(1H)-one(CAT: L030220) is a brominated heterocyclic compound featuring an ethyl group at the 1-position and a bromine atom at the 5-position on a pyridin-2-one core. This compound is a valuable intermediate in pharmaceutical research and organic synthesis, often used in the development of bioactive molecules and heterocyclic derivatives. Its unique substitution pattern provides versatility for chemical modifications, making it suitable for creating inhibitors, ligands, and other therapeutic candidates. With high purity and excellent stability, 5-Bromo-1-ethylpyridin-2(1H)-one is an essential building block for innovative drug discovery and advanced synthetic applications.
CAS Number | 63785-87-5 |
Molecular Formula | C7H8BrNO |
Purity | ≥95% |
IUPAC Name | 5-bromo-1-ethylpyridin-2-one |
InChI | InChI=1S/C7H8BrNO/c1-2-9-5-6(8)3-4-7(9)10/h3-5H,2H2,1H3 |
InChIKey | VTMWHOQCWLORMV-UHFFFAOYSA-N |
SMILES | CCN1C=C(C=CC1=O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |