For research use only. Not for therapeutic Use.
5-Bromo-1-isopropyl-1H-imidazole(Cat No.:L007240), is a chemical compound widely used in organic synthesis and pharmaceutical research. Its molecular formula is C6H9BrN2. This compound is essential in the development of pharmaceuticals and agrochemicals due to its unique structural features. Imidazole derivatives often exhibit various biological activities, making them valuable in medicinal chemistry. Researchers synthesize derivatives of 5-Bromo-1-isopropyl-1H-imidazole to explore their potential as antifungal, antibacterial, or antiviral agents. The presence of the bromine atom and the imidazole ring’s characteristics make it a versatile starting material, aiding in the creation of diverse biologically active compounds and contributing significantly to drug discovery efforts.
CAS Number | 1378632-40-6 |
Molecular Formula | C6H9BrN2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-1-propan-2-ylimidazole |
InChI | InChI=1S/C6H9BrN2/c1-5(2)9-4-8-3-6(9)7/h3-5H,1-2H3 |
InChIKey | DEPIVEKSFICIMI-UHFFFAOYSA-N |
SMILES | CC(C)N1C=NC=C1Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |