Home
>
Chemical Reagents>Heterocyclic Building Blocks> 5-Bromo-1-methyl-1,3-dihydro-2H-benzo[d]imidazol-2-one
For research use only. Not for therapeutic Use.
5-Bromo-1-methyl-1,3-dihydro-2H-benzo[d]imidazol-2-one is a heterocyclic compound featuring a bromine atom at the 5-position and a methyl group on the nitrogen of the benzimidazolone core. This compound is significant in medicinal chemistry due to its potential biological activities, including anticancer, antimicrobial, and anti-inflammatory properties. The bromine atom enhances its reactivity, making it a useful intermediate for chemical transformations. Its unique structure allows for further functionalization, making it valuable in drug discovery and organic synthesis.
CAS Number | 84712-08-3 |
Molecular Formula | C8H7BrN2O |
Purity | ≥95% |
IUPAC Name | 6-bromo-3-methyl-1H-benzimidazol-2-one |
InChI | InChI=1S/C8H7BrN2O/c1-11-7-3-2-5(9)4-6(7)10-8(11)12/h2-4H,1H3,(H,10,12) |
InChIKey | YNULJBICDDCLTN-UHFFFAOYSA-N |
SMILES | CN1C2=C(C=C(C=C2)Br)NC1=O |