For research use only. Not for therapeutic Use.
5-Bromo-1-methyl-1H-1,2,3-triazole(Cat No.:L012129)is a heterocyclic compound used in organic synthesis and pharmaceutical research. The molecule features a triazole ring with a bromine atom at the 5-position and a methyl group at the 1-position, offering unique reactivity for various chemical transformations. This compound is particularly valuable as an intermediate in the synthesis of biologically active molecules, including potential drug candidates. Its structure allows for versatile chemical modifications, making it essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced synthetic materials.
CAS Number | 16681-82-6 |
Molecular Formula | C3H4BrN3 |
Purity | ≥95% |
IUPAC Name | 5-bromo-1-methyltriazole |
InChI | InChI=1S/C3H4BrN3/c1-7-3(4)2-5-6-7/h2H,1H3 |
InChIKey | ZTGUHAUTOFRQDE-UHFFFAOYSA-N |
SMILES | CN1C(=CN=N1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |