For research use only. Not for therapeutic Use.
5-Bromo-1-(methylsulfonyl)indoline is a brominated indoline derivative commonly used in pharmaceutical and organic synthesis. Its structure, featuring a bromine atom and a methylsulfonyl group on an indoline core, provides enhanced reactivity and versatility, making it a valuable building block for creating complex bioactive molecules. This compound is often utilized in medicinal chemistry for drug discovery, as its framework supports the synthesis of molecules with potential therapeutic properties. Its applications extend to research in materials science and chemical biology.
Catalog Number | L021029 |
CAS Number | 446054-18-8 |
Molecular Formula | C9H10BrNO2S |
Purity | ≥95% |
IUPAC Name | 5-bromo-1-methylsulfonyl-2,3-dihydroindole |
InChI | InChI=1S/C9H10BrNO2S/c1-14(12,13)11-5-4-7-6-8(10)2-3-9(7)11/h2-3,6H,4-5H2,1H3 |
InChIKey | KLTSAXZCGBYCPU-UHFFFAOYSA-N |
SMILES | CS(=O)(=O)N1CCC2=C1C=CC(=C2)Br |