For research use only. Not for therapeutic Use.
5-Bromo-1-(phenylmethyl)-1H-indazole (Cat.No:L003582) is a notable chemical compound with versatile applications in medicinal chemistry. Its unique indazole scaffold, combined with the phenylmethyl group, holds promise for drug development. This compound’s distinctive structure contributes to its pharmacological properties, making it a valuable candidate for the synthesis of novel pharmaceutical agents.
CAS Number | 1087160-01-7 |
Molecular Formula | C14H11BrN2 |
Purity | ≥95% |
IUPAC Name | 1-benzyl-5-bromoindazole |
InChI | InChI=1S/C14H11BrN2/c15-13-6-7-14-12(8-13)9-16-17(14)10-11-4-2-1-3-5-11/h1-9H,10H2 |
InChIKey | KTTCZZNCIPVXKX-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)Br)C=N2 |