For research use only. Not for therapeutic Use.
5-Bromo-1,3-benzenediol (Cat.No:M008535) is a chemical compound with potential applications in organic synthesis. Its structure features a benzene ring substituted with a bromine atom and a hydroxyl group. This compound can serve as a versatile building block for creating various molecules in medicinal chemistry and other fields of research.
Catalog Number | M008535 |
CAS Number | 106120-04-1 |
Molecular Formula | C6H5BrO2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 5-bromobenzene-1,3-diol |
InChI | InChI=1S/C6H5BrO2/c7-4-1-5(8)3-6(9)2-4/h1-3,8-9H |
InChIKey | HYHHGFFTWSYNMV-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1O)Br)O |