For research use only. Not for therapeutic Use.
5-Bromo-1,3-dichloro-2-fluorobenzene (Cat.No:M127831) is a chemical compound used as a versatile building block in organic synthesis. Its unique halogen substituents make it valuable for creating complex molecules and pharmaceutical intermediates. Researchers and chemists often use this compound as a key reagent in the development of various organic compounds.
CAS Number | 17318-08-0 |
Molecular Formula | C6H2BrCl2F |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-bromo-1,3-dichloro-2-fluorobenzene |
InChI | InChI=1S/C6H2BrCl2F/c7-3-1-4(8)6(10)5(9)2-3/h1-2H |
InChIKey | MMJSIYGLDQNUTH-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1Cl)F)Cl)Br |