For research use only. Not for therapeutic Use.
5-Bromo-1,3-difluoro-2-isopropoxybenzene(Cat No.:M089701)is an aromatic compound featuring bromine and two fluorine atoms on a benzene ring, along with an isopropoxy group at the 2-position. This compound is used in pharmaceutical research and organic synthesis as a building block for the development of biologically active molecules, including potential drug candidates. Its halogenated structure offers unique reactivity, making it suitable for a range of chemical transformations such as cross-coupling and substitution reactions. Researchers in medicinal chemistry use this compound to explore innovative chemical pathways and therapeutic agents.
CAS Number | 1309933-98-9 |
Molecular Formula | C9H9BrF2O |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 5-bromo-1,3-difluoro-2-propan-2-yloxybenzene |
InChI | InChI=1S/C9H9BrF2O/c1-5(2)13-9-7(11)3-6(10)4-8(9)12/h3-5H,1-2H3 |
InChIKey | BJEWMUWBTRMAJT-UHFFFAOYSA-N |
SMILES | CC(C)OC1=C(C=C(C=C1F)Br)F |