For research use only. Not for therapeutic Use.
5-Bromo-1,3-dihydrobenzoimidazol-2-one(Cat No.:L030022)is a heterocyclic compound used in pharmaceutical research and organic synthesis. The molecule features a benzoimidazole core with a bromine atom at the 5-position and a carbonyl group at the 2-position, providing unique reactivity. This compound is particularly valuable as an intermediate in the synthesis of biologically active molecules, including potential drug candidates. The presence of the bromine atom allows for further functionalization through cross-coupling reactions, making it essential for researchers focused on drug discovery, medicinal chemistry, and the development of advanced therapeutic agents.
CAS Number | 39513-26-3 |
Molecular Formula | C7H5BrN2O |
Purity | ≥95% |
IUPAC Name | 5-bromo-1,3-dihydrobenzimidazol-2-one |
InChI | InChI=1S/C7H5BrN2O/c8-4-1-2-5-6(3-4)10-7(11)9-5/h1-3H,(H2,9,10,11) |
InChIKey | VWIGEYVTDXNDHV-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1Br)NC(=O)N2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |