For research use only. Not for therapeutic Use.
5-Bromo-1H-imidazole-2-carboxylic acid hydrochloride (Cat.No:L004087) is a significant chemical compound used in pharmaceutical research. Its unique structure, incorporating a bromoimidazole and carboxylic acid motif, imparts specialized reactivity. This compound serves as a crucial intermediate in the synthesis of specialized molecules with potential pharmaceutical activity.
CAS Number | 2375260-25-4 |
Molecular Formula | C4H4BrClN2O2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-1H-imidazole-2-carboxylic acid;hydrochloride |
InChI | InChI=1S/C4H3BrN2O2.ClH/c5-2-1-6-3(7-2)4(8)9;/h1H,(H,6,7)(H,8,9);1H |
InChIKey | GFCPJBNHDOELKJ-UHFFFAOYSA-N |
SMILES | C1=C(NC(=N1)C(=O)O)Br.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |