For research use only. Not for therapeutic Use.
5-Bromo-1H-indazole(CAT: L016534) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring a bromine substituent at the 5-position of the indazole core, it serves as a versatile building block for synthesizing bioactive molecules, including potential therapeutic agents and enzyme inhibitors. Its structure enables diverse chemical transformations, such as cross-coupling and halogenation reactions, facilitating the development of novel derivatives. With consistent performance and reliable reactivity, 5-Bromo-1H-indazole is a valuable resource for advancing medicinal chemistry and innovative organic synthesis applications.
CAS Number | 465529-55-9 |
Molecular Formula | C7H5BrN2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-1H-indazole |
InChI | InChI=1S/C7H5BrN2/c8-6-1-2-7-5(3-6)4-9-10-7/h1-4H,(H,9,10) |
InChIKey | STVHMYNPQCLUNJ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1Br)C=NN2 |