5-Bromo-1H-pyrazole-3-carboxylic Acid(Cat No.:L048785)is a valuable chemical intermediate known for its versatile applications in pharmaceuticals and agrochemicals. It features a pyrazole ring, a recognized scaffold in drug design due to its biological relevance. The 5-bromo substitution enhances the compound’s reactivity, making it suitable for further functionalization through coupling reactions. The carboxylic acid group at the 3-position increases its solubility and provides a functional handle for esterification or amidation. This compound is essential in synthesizing novel bioactive molecules, playing a crucial role in developing new therapeutic agents and agricultural products.
Catalog Number | L048785 |
CAS Number | 1905484-46-9 |
Molecular Formula | C4H3BrN2O2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-1H-pyrazole-3-carboxylic acid |
InChI | InChI=1S/C4H3BrN2O2/c5-3-1-2(4(8)9)6-7-3/h1H,(H,6,7)(H,8,9) |
InChIKey | OOKGNGYUNBYGEL-UHFFFAOYSA-N |
SMILES | C1=C(NN=C1C(=O)O)Br |