For research use only. Not for therapeutic Use.
5-Bromo-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde is a heterocyclic compound featuring a fused pyrrole-pyridine structure, with a bromine atom at the 5-position and an aldehyde group at the 3-position. This unique arrangement offers both electrophilic and nucleophilic sites, making it valuable in synthetic chemistry as an intermediate in complex molecule synthesis. Its structure is particularly useful in pharmaceutical research for the development of kinase inhibitors and other bioactive compounds, contributing to targeted drug discovery in oncology and inflammatory diseases.
CAS Number | 757978-33-9 |
Molecular Formula | C8H5BrN2O |
Purity | ≥95% |
IUPAC Name | 5-bromo-1H-pyrrolo[2,3-b]pyridine-3-carbaldehyde |
InChI | InChI=1S/C8H5BrN2O/c9-6-1-7-5(4-12)2-10-8(7)11-3-6/h1-4H,(H,10,11) |
InChIKey | YLZQPOVEHGBMFG-UHFFFAOYSA-N |
SMILES | C1=C(C=NC2=C1C(=CN2)C=O)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |