For research use only. Not for therapeutic Use.
5-Bromo-2-(2-methyl-2H-tetrazol-5-yl)pyridine is a pyridine derivative featuring a bromine substituent and a tetrazole moiety. This compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. The bromine atom enhances reactivity, enabling various chemical modifications and applications in drug development. Researchers explore its role as a scaffold for synthesizing novel therapeutic agents, particularly those targeting specific disease mechanisms, thereby contributing to the advancement of pharmacological research and discovery.
CAS Number | 380380-64-3 |
Synonyms | 2-(2-Methyl-5-tetrazolyl)-5-bromopyridine; 5-Bromo-2-(2-methyl-2H-tetrazol-5-yl)pyridine |
Molecular Formula | C7H6BrN5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-bromo-2-(2-methyltetrazol-5-yl)pyridine |
InChI | InChI=1S/C7H6BrN5/c1-13-11-7(10-12-13)6-3-2-5(8)4-9-6/h2-4H,1H3 |
InChIKey | JANKGNBDRWYWSN-UHFFFAOYSA-N |
SMILES | CN1N=C(N=N1)C2=NC=C(C=C2)Br |