For research use only. Not for therapeutic Use.
5-Bromo-2-(3-fluorophenoxy)pyridine (Cat.No:L003539) is a crucial chemical compound in pharmaceutical research. Its distinctive structure, featuring a bromine substituent and a fluorophenyl group, imparts valuable pharmacological properties. This compound serves as a pivotal intermediate in the synthesis of potential drug candidates, making it a key player in the development of innovative pharmaceuticals.
Catalog Number | L003539 |
CAS Number | 936343-48-5 |
Molecular Formula | C11H7BrFNO |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-(3-fluorophenoxy)pyridine |
InChI | InChI=1S/C11H7BrFNO/c12-8-4-5-11(14-7-8)15-10-3-1-2-9(13)6-10/h1-7H |
InChIKey | IGNBVJSHHGWJMR-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)F)OC2=NC=C(C=C2)Br |