For research use only. Not for therapeutic Use.
5-Bromo-2-((4-methoxybenzyl)oxy)benzaldehyde(CAT: L000333) finds its significance primarily in the field of organic chemistry and pharmaceuticals. This compound, featuring a benzaldehyde core with a bromine atom and a 4-methoxybenzyl ether group, plays a vital role as a versatile building block for the synthesis of various organic molecules and pharmaceutical intermediates. In the realm of organic chemistry, it serves as a crucial reagent for creating structurally diverse compounds.
CAS Number | 325457-67-8 |
Molecular Formula | C15H13BrO3 |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-[(4-methoxyphenyl)methoxy]benzaldehyde |
InChI | InChI=1S/C15H13BrO3/c1-18-14-5-2-11(3-6-14)10-19-15-7-4-13(16)8-12(15)9-17/h2-9H,10H2,1H3 |
InChIKey | NJXRREPHOPEYPB-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |