For research use only. Not for therapeutic Use.
5-Bromo-2-chlorophenylboronic acid(CAT: L041723) is a halogenated aromatic boronic acid featuring bromine at the 5-position, chlorine at the 2-position, and a boronic acid functional group on the phenyl ring. This compound is a valuable intermediate in chemical and pharmaceutical research, particularly in Suzuki-Miyaura cross-coupling reactions for constructing biaryl and heteroaryl compounds. Its dual halogenation enhances reactivity and selectivity, making it a versatile building block for synthesizing bioactive molecules, agrochemicals, and advanced materials. With high purity and stability, 5-Bromo-2-chlorophenylboronic acid is an essential reagent for medicinal chemistry and innovative organic synthesis projects.
CAS Number | 774608-50-3 |
Molecular Formula | C6H5BBrClO2 |
Purity | ≥95% |
IUPAC Name | (5-bromo-2-chlorophenyl)boronic acid |
InChI | InChI=1S/C6H5BBrClO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
InChIKey | IWUGPRLLWXXECY-UHFFFAOYSA-N |
SMILES | B(C1=C(C=CC(=C1)Br)Cl)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |