For research use only. Not for therapeutic Use.
5-Bromo-2-chloropyridine-4-carbaldehyde(Cat No.:L012280)is a heterocyclic compound with a bromine atom at the 5-position, a chlorine atom at the 2-position, and an aldehyde group at the 4-position of a pyridine ring. This compound is widely used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. The combination of halogens and the aldehyde group on the pyridine ring enhances its reactivity, allowing for further functionalization and derivatization. It is particularly valuable in medicinal chemistry for constructing complex molecules with potential therapeutic properties.
CAS Number | 1060802-23-4 |
Molecular Formula | C6H3BrClNO |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-chloropyridine-4-carbaldehyde |
InChI | InChI=1S/C6H3BrClNO/c7-5-2-9-6(8)1-4(5)3-10/h1-3H |
InChIKey | MAGFXBKNQAAQQA-UHFFFAOYSA-N |
SMILES | C1=C(C(=CN=C1Cl)Br)C=O |