For research use only. Not for therapeutic Use.
5-Bromo-2-chloropyrrolo[2,1-f][1,2,4]triazine(CAT: L012979) is a high-purity heterocyclic compound featuring a bromine and chlorine atom on a pyrrolo-triazine scaffold. This versatile molecule serves as a key intermediate in pharmaceutical research, particularly in the development of bioactive compounds such as kinase inhibitors and therapeutic agents. Its unique structure and electronic properties make it ideal for advanced chemical transformations and the synthesis of functional materials. 5-Bromo-2-chloropyrrolo[2,1-f][1,2,4]triazine supports innovative research in medicinal chemistry and fine chemical production, offering consistent performance for complex synthetic pathways.
CAS Number | 1233143-59-3 |
Molecular Formula | C6H3BrClN3 |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-chloropyrrolo[2,1-f][1,2,4]triazine |
InChI | InChI=1S/C6H3BrClN3/c7-4-1-2-11-5(4)3-9-6(8)10-11/h1-3H |
InChIKey | AXXQRRWVSIJWNS-UHFFFAOYSA-N |
SMILES | C1=CN2C(=C1Br)C=NC(=N2)Cl |