For research use only. Not for therapeutic Use.
5-Bromo-2-ethylbenzofuran(Cat No.:L034839)is a high-purity aromatic compound commonly used in pharmaceutical and chemical research. This molecule features a bromine atom and an ethyl group attached to a benzofuran core, making it a valuable intermediate in the synthesis of bioactive molecules, including potential drug candidates and agrochemicals. Its unique structure allows for selective reactivity in various chemical transformations, supporting the development of novel therapeutic agents. 5-Bromo-2-ethylbenzofuran is ideal for precise synthetic applications, contributing to advancements in medicinal chemistry and innovative research.
Catalog Number | L034839 |
CAS Number | 39178-60-4 |
Molecular Formula | C10H9BrO |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-ethyl-1-benzofuran |
InChI | InChI=1S/C10H9BrO/c1-2-9-6-7-5-8(11)3-4-10(7)12-9/h3-6H,2H2,1H3 |
InChIKey | IXCGZKOZXSKKFI-UHFFFAOYSA-N |
SMILES | CCC1=CC2=C(O1)C=CC(=C2)Br |