For research use only. Not for therapeutic Use.
5-Bromo-2-(ethylsulfonyl)pyridine(Cat No.:L007612), is a chemical compound featuring a pyridine ring substituted with a bromine atom at the 5-position and an ethylsulfonyl group at the 2-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a versatile building block for the creation of complex organic molecules. Its unique combination of a pyridine ring and a sulfonyl group allows for diverse chemical modifications, making it valuable in the design and synthesis of novel compounds.
CAS Number | 223556-06-7 |
Molecular Formula | C7H8BrNO2S |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-ethylsulfonylpyridine |
InChI | InChI=1S/C7H8BrNO2S/c1-2-12(10,11)7-4-3-6(8)5-9-7/h3-5H,2H2,1H3 |
InChIKey | XGEVUUWBNIEEQH-UHFFFAOYSA-N |
SMILES | CCS(=O)(=O)C1=NC=C(C=C1)Br |