For research use only. Not for therapeutic Use.
5-Bromo-2-fluoro-3-iodopyridine (Cat.No:L003563) is a pivotal chemical compound with diverse applications in pharmaceutical and agrochemical research. Its unique combination of halogen substituents endows it with valuable reactivity, making it a crucial building block in the synthesis of complex organic molecules. This compound’s significance lies in its role as a key intermediate in the development of novel pharmaceuticals and agrochemicals, underscoring its importance in advancing both the healthcare and agriculture industries.
| Catalog Number | L003563 |
| CAS Number | 1214376-88-1 |
| Molecular Formula | C5H2BrFIN |
| Purity | ≥95% |
| IUPAC Name | 5-bromo-2-fluoro-3-iodopyridine |
| InChI | InChI=1S/C5H2BrFIN/c6-3-1-4(8)5(7)9-2-3/h1-2H |
| InChIKey | AVDATZWZGDTYDM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1I)F)Br |
