For research use only. Not for therapeutic Use.
5-Bromo-2-iodopyrimidine (Cat.No:R024217) is a chemical compound used in organic synthesis and pharmaceutical research. It is a valuable building block for the preparation of various biologically active compounds. 5-Bromo-2-iodopyrimidine’s unique structure makes it a versatile intermediate in medicinal chemistry, facilitating the development of potential pharmaceutical agents.
Catalog Number | R024217 |
CAS Number | 183438-24-6 |
Synonyms | 2-Iodo-5-bromopyrimidine |
Molecular Formula | C4H2BrIN2 |
Purity | ≥95% |
Storage | -20 ℃ |
IUPAC Name | 5-bromo-2-iodopyrimidine |
InChI | InChI=1S/C4H2BrIN2/c5-3-1-7-4(6)8-2-3/h1-2H |
InChIKey | ZEZKXPQIDURFKA-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=N1)I)Br |