Home
>
Inhibitors/Agonists>Cell Cycle>Casein Kinase>
>
5-Bromo-2-methoxy-4-(((3-(methylthio)-5-phenyl-4H-1,2,4-triazol-4-yl)imino)methyl)phenol
For research use only. Not for therapeutic Use.
5-Bromo-2-methoxy-4-(((3-(methylthio)-5-phenyl-4H-1,2,4-triazol-4-yl)imino)methyl)phenol(Cat No.:L000574)is a complex organic compound characterized by a brominated methoxy-substituted phenol moiety linked to a triazole derivative. This compound has potential applications in medicinal chemistry, particularly as a candidate for antifungal or anticancer agents due to the presence of the triazole ring, known for its biological activity. Its unique structure may facilitate interactions with biological targets, enhancing therapeutic efficacy. Ongoing research is focused on evaluating its pharmacological properties, mechanisms of action, and potential uses in various therapeutic contexts.
Catalog Number | L000574 |
CAS Number | 694522-87-7 |
Molecular Formula | C17H15BrN4O2S |
Purity | ≥95% |
Target | Stem Cell/Wnt |
IUPAC Name | 5-bromo-2-methoxy-4-[(E)-(3-methylsulfanyl-5-phenyl-1,2,4-triazol-4-yl)iminomethyl]phenol |
InChI | InChI=1S/C17H15BrN4O2S/c1-24-15-8-12(13(18)9-14(15)23)10-19-22-16(20-21-17(22)25-2)11-6-4-3-5-7-11/h3-10,23H,1-2H3/b19-10+ |
InChIKey | DARDDBZKGVEVKB-VXLYETTFSA-N |
SMILES | COC1=C(C=C(C(=C1)/C=N/N2C(=NN=C2SC)C3=CC=CC=C3)Br)O |