For research use only. Not for therapeutic Use.
5-Bromo-2-methoxybenzene-1-sulfonyl fluoride(Cat No.:L007793), is a chemical compound with the molecular formula C₇H₆BrFO₃S. This compound contains a sulfonyl fluoride functional group, a bromine atom, and a methoxy group attached to a benzene ring. Sulfonyl fluorides are versatile intermediates in organic synthesis, commonly used in the preparation of various pharmaceuticals and agrochemicals. The presence of both a sulfonyl fluoride and a halogen atom in this compound makes it valuable for diverse chemical transformations, enabling the creation of complex molecules.
CAS Number | 457051-09-1 |
Molecular Formula | C7H6BrFO3S |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-methoxybenzenesulfonyl fluoride |
InChI | InChI=1S/C7H6BrFO3S/c1-12-6-3-2-5(8)4-7(6)13(9,10)11/h2-4H,1H3 |
InChIKey | SQXFRZSRCGSBKW-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1)Br)S(=O)(=O)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |