For research use only. Not for therapeutic Use.
5-Bromo-2-methyl-1H-pyrrolo[2,3-b]pyridine(CAT: L042404) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring a pyrrolo[2,3-b]pyridine core with a bromine atom at the 5-position and a methyl group at the 2-position, this compound serves as a versatile intermediate for the synthesis of bioactive molecules and potential drug candidates. Its unique structure and reactivity make it particularly valuable in medicinal chemistry for developing enzyme inhibitors, receptor modulators, and other therapeutic agents. 5-Bromo-2-methyl-1H-pyrrolo[2,3-b]pyridine ensures consistent performance and reliability, supporting innovative research in drug discovery and advanced synthetic methodologies.
CAS Number | 1111638-02-8 |
Molecular Formula | C8H7BrN2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-methyl-1H-pyrrolo[2,3-b]pyridine |
InChI | InChI=1S/C8H7BrN2/c1-5-2-6-3-7(9)4-10-8(6)11-5/h2-4H,1H3,(H,10,11) |
InChIKey | IWLFWGLFINYFHA-UHFFFAOYSA-N |
SMILES | CC1=CC2=CC(=CN=C2N1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |