For research use only. Not for therapeutic Use.
5-Bromo-2-methyl-2-pentene (Cat.No:L003637) is a notable chemical compound with diverse applications in organic synthesis. Its unique structure, characterized by a bromine-substituted pentene moiety, makes it a valuable building block for the preparation of various specialized compounds. This compound finds utility in pharmaceutical and agrochemical research, as well as in the development of advanced materials.
CAS Number | 2270-59-9 |
Molecular Formula | C6H11Br |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-methylpent-2-ene |
InChI | InChI=1S/C6H11Br/c1-6(2)4-3-5-7/h4H,3,5H2,1-2H3 |
InChIKey | UNXURIHDFUQNOC-UHFFFAOYSA-N |
SMILES | CC(=CCCBr)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |