For research use only. Not for therapeutic Use.
5-Bromo-2-methyl-4-nitropyridine 1-oxide(Cat No.:L006683), is a chemical compound featuring a pyridine ring substituted with bromine, methyl, nitro, and oxide groups. This compound holds significance in organic synthesis and pharmaceutical research. Nitropyridines, including this compound, are key intermediates in the preparation of various functionalized pyridines, which are important in drug discovery and agrochemical industries. The presence of the nitro group enhances its reactivity, making it valuable in the synthesis of complex organic molecules.
CAS Number | 62516-08-9 |
Molecular Formula | C6H5BrN2O3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 5-bromo-2-methyl-4-nitro-1-oxidopyridin-1-ium |
InChI | InChI=1S/C6H5BrN2O3/c1-4-2-6(9(11)12)5(7)3-8(4)10/h2-3H,1H3 |
InChIKey | ZXBHWFBOEKPCCN-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=[N+]1[O-])Br)[N+](=O)[O-] |