Home
>
Chemical Reagents>Heterocyclic Building Blocks> 5-Bromo-2-methyl-4-(trifluoromethyl)pyrimidine
For research use only. Not for therapeutic Use.
5-Bromo-2-methyl-4-(trifluoromethyl)pyrimidine(Cat No.:L013513)is a halogenated pyrimidine derivative widely used in pharmaceutical and chemical research. Featuring a bromine atom at the 5-position, a methyl group at the 2-position, and a trifluoromethyl group at the 4-position, this compound is valuable as a building block in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure facilitates diverse chemical transformations, making it essential in developing pharmaceuticals, agrochemicals, and advanced materials. 5-Bromo-2-methyl-4-(trifluoromethyl)pyrimidine is crucial for researchers focused on innovative medicinal chemistry.
Catalog Number | L013513 |
CAS Number | 1781830-29-2 |
Molecular Formula | C6H4BrF3N2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-methyl-4-(trifluoromethyl)pyrimidine |
InChI | InChI=1S/C6H4BrF3N2/c1-3-11-2-4(7)5(12-3)6(8,9)10/h2H,1H3 |
InChIKey | QBQQCGIZPGZWPB-UHFFFAOYSA-N |
SMILES | CC1=NC=C(C(=N1)C(F)(F)F)Br |