For research use only. Not for therapeutic Use.
5-Bromo-2-methylbenzoic acid(Cat No.:M022563), is a chemical compound with the molecular formula C8H7BrO2. It features a benzoic acid backbone with both a bromine atom and a methyl group attached. This compound’s unique structure signifies its potential in various chemical applications, including organic synthesis. The presence of the bromine atom and the methyl group on the benzoic acid can impact its reactivity and properties, making it valuable for creating specialized molecules used in pharmaceuticals, agrochemicals, and other fine chemicals. Its specific functional groups offer opportunities for diverse reactions and transformations.
CAS Number | 79669-49-1 |
Synonyms | 5-BROMO-2-METHYLBENZOIC ACID;2-METHYL-5-BROMOBENZOIC ACID;5-Bromo-o-toluic acid;5-Bromo-o-toluicacid(COOH=1);5-BROMO-2-METHYLBENZOIC ACID,98%;5-Bromo-2-methylbenzoic acid ,97%;2,3,4,6-tetrakis-O-triMethylsilyl-D-guluconolactone;5-Bromo-o-toluic acid, |
Molecular Formula | C8H7BrO2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 5-bromo-2-methylbenzoic acid |
InChI | InChI=1S/C8H7BrO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
InChIKey | SEENCYZQHCUTSB-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1)Br)C(=O)O |