For research use only. Not for therapeutic Use.
5-Bromo-2-methylnicotinic acid(Cat No.:L037997)is a halogenated pyridine derivative widely used in pharmaceutical and chemical research. Featuring a nicotinic acid core with a bromine atom at the 5-position and a methyl group at the 2-position, this compound serves as a crucial intermediate in the synthesis of bioactive molecules, including potential therapeutic agents and agrochemicals. Its structure allows for selective chemical modifications, making it valuable in the development of drugs targeting various diseases. Additionally, it plays a role in creating complex organic compounds and advanced materials in medicinal chemistry.
CAS Number | 351003-02-6 |
Molecular Formula | C7H6BrNO2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-methylpyridine-3-carboxylic acid |
InChI | InChI=1S/C7H6BrNO2/c1-4-6(7(10)11)2-5(8)3-9-4/h2-3H,1H3,(H,10,11) |
InChIKey | WOVLKYARFQYAMN-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=N1)Br)C(=O)O |