For research use only. Not for therapeutic Use.
5-Bromo-2-(piperidin-3-yloxy)pyrimidine(Cat No.:L037716)is a heterocyclic compound featuring a bromine atom at the 5-position of a pyrimidine ring and a piperidin-3-yloxy group at the 2-position. This compound is commonly used in pharmaceutical research and organic synthesis as a versatile intermediate for developing biologically active molecules, including drug candidates. Its structure offers unique reactivity, making it suitable for various chemical transformations such as cross-coupling and substitution reactions. Researchers in medicinal chemistry value this compound for designing novel therapeutic agents and exploring innovative drug discovery pathways.
Catalog Number | L037716 |
CAS Number | 914347-73-2 |
Molecular Formula | C9H12BrN3O |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-piperidin-3-yloxypyrimidine |
InChI | InChI=1S/C9H12BrN3O/c10-7-4-12-9(13-5-7)14-8-2-1-3-11-6-8/h4-5,8,11H,1-3,6H2 |
InChIKey | HBAYDUMSWQKSEP-UHFFFAOYSA-N |
SMILES | C1CC(CNC1)OC2=NC=C(C=N2)Br |