For research use only. Not for therapeutic Use.
5-Bromo-2,3-dimethylbenzoic acid(Cat No.:L007782), is a chemical compound with the molecular formula C₉H₉BrO₂. This compound belongs to the class of benzoic acids, characterized by a benzene ring with a carboxylic acid group (-COOH) attached. The presence of a bromine atom (Br) and two methyl groups (CH₃) on the benzene ring imparts specific chemical properties to this compound, making it useful in various organic synthesis processes. Benzoic acids and their derivatives are widely employed in the production of pharmaceuticals, dyes, and fragrances, as well as serving as intermediates in organic chemical manufacturing.
CAS Number | 5613-27-4 |
Molecular Formula | C9H9BrO2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-2,3-dimethylbenzoic acid |
InChI | InChI=1S/C9H9BrO2/c1-5-3-7(10)4-8(6(5)2)9(11)12/h3-4H,1-2H3,(H,11,12) |
InChIKey | ZCZLDHYJFFDDOE-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=C1C)C(=O)O)Br |