For research use only. Not for therapeutic Use.
5-Bromo-2,3,4-trifluorobenzoic acid (Cat.No:L003426) is a vital chemical compound with versatile applications in pharmaceutical research. Its distinctive structure and reactivity make it a valuable building block for the synthesis of specialized materials and pharmaceuticals. This compound plays a pivotal role in the development of innovative drugs, underscoring its significance in contemporary medicinal chemistry endeavors.
CAS Number | 212631-85-1 |
Molecular Formula | C7H2BrF3O2 |
Purity | ≥95% |
IUPAC Name | 5-bromo-2,3,4-trifluorobenzoic acid |
InChI | InChI=1S/C7H2BrF3O2/c8-3-1-2(7(12)13)4(9)6(11)5(3)10/h1H,(H,12,13) |
InChIKey | XQIATTAAVBLNAN-UHFFFAOYSA-N |
SMILES | C1=C(C(=C(C(=C1Br)F)F)F)C(=O)O |