For research use only. Not for therapeutic Use.
5-Bromo-2,4-dimethyl-1,3-thiazole is a heterocyclic compound featuring a thiazole ring with bromine and two methyl groups at specific positions. The presence of the bromine atom at the 5-position enhances its reactivity, making it useful in organic synthesis and medicinal chemistry. This compound exhibits potential biological activity, often studied for its antimicrobial and antifungal properties. Its unique structure allows for various applications in pharmaceuticals and agrochemicals, making it a valuable intermediate in chemical research and development.
Catalog Number | L031232 |
CAS Number | 28599-52-2 |
Molecular Formula | C5H6BrNS |
Purity | ≥95% |
IUPAC Name | 5-bromo-2,4-dimethyl-1,3-thiazole |
InChI | InChI=1S/C5H6BrNS/c1-3-5(6)8-4(2)7-3/h1-2H3 |
InChIKey | BSFCVAYFJQLZEU-UHFFFAOYSA-N |
SMILES | CC1=C(SC(=N1)C)Br |