For research use only. Not for therapeutic Use.
5-Bromo-2,4-dimethylpyridine(CAT: L038228) is a brominated heterocyclic compound frequently used in pharmaceutical and synthetic chemistry. Its structure features a pyridine ring substituted with bromine at the 5-position and methyl groups at the 2- and 4-positions, offering a combination of electronic and steric properties that enhance its utility in organic synthesis. This compound serves as a key intermediate in the preparation of bioactive molecules, particularly in the development of agrochemicals, pharmaceuticals, and advanced materials. Its reactivity makes it suitable for coupling reactions and further functionalization. Researchers rely on 5-Bromo-2,4-dimethylpyridine for designing innovative compounds in medicinal chemistry and material science applications.
CAS Number | 27063-92-9 |
Molecular Formula | C7H8BrN |
Purity | ≥95% |
IUPAC Name | 5-bromo-2,4-dimethylpyridine |
InChI | InChI=1S/C7H8BrN/c1-5-3-6(2)9-4-7(5)8/h3-4H,1-2H3 |
InChIKey | SLMUXUHXAIPROA-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC=C1Br)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |