For research use only. Not for therapeutic Use.
5-Bromo-3-fluoro-2-(trifluoromethoxy)pyridine (Cat.No:L003355) is a crucial chemical compound with versatile applications in agrochemicals and pharmaceuticals. Its distinct structure and reactivity make it a valuable building block in the synthesis of novel compounds, highlighting its importance in modern chemical research.
CAS Number | 1361893-62-0 |
Molecular Formula | C6H2BrF4NO |
Purity | ≥95% |
IUPAC Name | 5-bromo-3-fluoro-2-(trifluoromethoxy)pyridine |
InChI | InChI=1S/C6H2BrF4NO/c7-3-1-4(8)5(12-2-3)13-6(9,10)11/h1-2H |
InChIKey | YSTFAASXGKFLQW-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=C1F)OC(F)(F)F)Br |