For research use only. Not for therapeutic Use.
5-Bromo-3-iodoquinoline is an organic compound featuring a quinoline ring with a bromine atom at the fifth position and an iodine atom at the third position. Its chemical formula is C₉H₆BrI₁N. This compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anticancer properties. The presence of halogen substituents enhances its reactivity and allows for further functionalization, making it a valuable building block for the synthesis of novel pharmaceuticals and other bioactive compounds.
CAS Number | 1416438-35-1 |
Molecular Formula | C9H5BrIN |
Purity | ≥95% |
IUPAC Name | 5-bromo-3-iodoquinoline |
InChI | InChI=1S/C9H5BrIN/c10-8-2-1-3-9-7(8)4-6(11)5-12-9/h1-5H |
InChIKey | ROVSCGDRAGSGQB-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C(C=N2)I)C(=C1)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |