For research use only. Not for therapeutic Use.
5-Bromo-3-isopropyl-2-methyl-3H-imidazo[4,5-B]pyridine(CAT: L028906) is a heterocyclic compound that holds significance in medicinal chemistry and pharmaceutical research. Its imidazopyridine core structure is often used as a building block in the synthesis of bioactive molecules, including drug candidates targeting various biological pathways. The bromine substitution at the 5-position and the alkyl groups at the 3- and 2-positions introduce steric and electronic effects that can modify the compound’s activity, binding affinity, and pharmacokinetics. This compound is typically explored in drug discovery programs focused on kinase inhibition, receptor modulation, or antiviral therapies.
CAS Number | 1784871-38-0 |
Molecular Formula | C10H12BrN3 |
Purity | ≥95% |
IUPAC Name | 5-bromo-2-methyl-3-propan-2-ylimidazo[4,5-b]pyridine |
InChI | InChI=1S/C10H12BrN3/c1-6(2)14-7(3)12-8-4-5-9(11)13-10(8)14/h4-6H,1-3H3 |
InChIKey | KARQRQWTKJYTON-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |