Home
>
Inhibitors/Agonists>Endocrinology and Hormones>Other Inhibitors> 5-Bromo-3-(piperidin-1-yl)pyridin-2-amine
For research use only. Not for therapeutic Use.
5-Bromo-3-(piperidine-1-yl) pyridine-2-amine(Cat No.:L049186), is a chemical compound used in organic synthesis and pharmaceutical research. It is a pyridine derivative with a bromine atom at position 5 and a piperidine-1-yl group at position 3 of the pyridine ring. This versatile compound serves as an important intermediate in the synthesis of various organic molecules and pharmaceutical agents, making it valuable in drug development and medicinal chemistry research. Its unique structure allows for the introduction of specific functional groups, potentially enhancing biological activities or pharmacological properties.
CAS Number | 1335058-51-9 |
Molecular Formula | C10H14BrN3 |
Purity | ≥95% |
IUPAC Name | 5-bromo-3-piperidin-1-ylpyridin-2-amine |
InChI | InChI=1S/C10H14BrN3/c11-8-6-9(10(12)13-7-8)14-4-2-1-3-5-14/h6-7H,1-5H2,(H2,12,13) |
InChIKey | BCKOGRQJSVDDAK-UHFFFAOYSA-N |
SMILES | C1CCN(CC1)C2=C(N=CC(=C2)Br)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |