For research use only. Not for therapeutic Use.
(5-Bromo-3-(trifluoromethyl)pyridin-2-yl)methanol is a pyridine derivative characterized by a bromine atom at the 5-position and a trifluoromethyl group at the 3-position, along with a methanol functional group. This compound is significant in medicinal chemistry due to its potential biological activities, including antibacterial and antifungal properties. The trifluoromethyl group enhances lipophilicity, while the bromine and hydroxyl groups facilitate further chemical transformations. Its unique structure allows for diverse applications in drug development and the synthesis of bioactive compounds.
CAS Number | 1206968-90-2 |
Molecular Formula | C7H5BrF3NO |
Purity | ≥95% |
IUPAC Name | [5-bromo-3-(trifluoromethyl)pyridin-2-yl]methanol |
InChI | InChI=1S/C7H5BrF3NO/c8-4-1-5(7(9,10)11)6(3-13)12-2-4/h1-2,13H,3H2 |
InChIKey | QMAJKOPVUYTESD-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=C1C(F)(F)F)CO)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |