Home
>
Chemical Reagents>Organometallic Reagents> 5-BRomo-4-chloro-2-fluoro-3-methylphenylboronic acid
For research use only. Not for therapeutic Use.
5-Bromo-4-chloro-2-fluoro-3-methylphenylboronic acid (CAT: L000236) is a significant compound in pharmaceutical and organic chemistry. This chemical acts as a versatile reagent for the synthesis of complex organic molecules, particularly in medicinal chemistry. Its action method involves introducing the boronic acid group into various organic structures, making it a valuable tool in drug development
Catalog Number | L000236 |
CAS Number | 2377606-52-3 |
Molecular Formula | C7H6BBrClFO2 |
Purity | ≥95% |
IUPAC Name | (5-bromo-4-chloro-2-fluoro-3-methylphenyl)boronic acid |
InChI | InChI=1S/C7H6BBrClFO2/c1-3-6(10)5(9)2-4(7(3)11)8(12)13/h2,12-13H,1H3 |
InChIKey | SLLQNDQZNONIRM-UHFFFAOYSA-N |