For research use only. Not for therapeutic Use.
X-Gal(CAS 7240-90-6) is a cell-permeable, chromogenic substrate for β-galactosidase that is used in histochemical and molecular biology applications, including detection of lacZ activity in cells and tissues. It generates an indigo-colored precipitate as an indication of enzymatic activity.
| Catalog Number | R000041 |
| CAS Number | 7240-90-6 |
| Synonyms | 5-Bromo-4-chloro-1H-indol-3-yl β-D-Galactopyranoside; 5-Bromo-4-chloroindol-3-yl β-D-galactoside; X-GAL; |
| Molecular Formula | C14H15BrClNO6 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChI | InChI=1S/C14H15BrClNO6/c15-5-1-2-6-9(10(5)16)7(3-17-6)22-14-13(21)12(20)11(19)8(4-18)23-14/h1-3,8,11-14,17-21H,4H2/t8-,11+,12+,13-,14-/m1/s1 |
| InChIKey | OPIFSICVWOWJMJ-AEOCFKNESA-N |
| SMILES | C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)CO)O)O)O)Cl)Br |
| Reference | <span style="color:#000000;"><span style="font-family:arial,helvetica,sans-serif;"><span style="font-size:12px;">1.Sambrook, J., and Russell, D.W. Molecular cloning: A laboratory manual. 3, 1-21 (2001).</span></span></span> |
